| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid Basic information |
| Product Name: | 1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid | | Synonyms: | (1S,3S)-1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid;1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid;Cyclobutanecarboxylic acid, 1-(4-chlorophenyl)-3-hydroxy-, trans-;trans-1-(4-Chlorophenyl)-3-hydroxycyclobutanecarboxylic acid;rel-(1r,3r)-1-(4-Chlorophenyl)-3-hydroxycyclobutanecarboxylicacid | | CAS: | 1145681-01-1 | | MF: | C11H11ClO3 | | MW: | 226.66 | | EINECS: | | | Product Categories: | | | Mol File: | 1145681-01-1.mol |  |
| | 1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid Chemical Properties |
| Boiling point | 409.889±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.464±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 4.002±0.40(predicted) | | form | solid | | InChI | 1S/C11H11ClO3/c12-8-3-1-7(2-4-8)11(10(14)15)5-9(13)6-11/h1-4,9,13H,5-6H2,(H,14,15) | | InChIKey | PQVUQOBVSQOFKH-UHFFFAOYSA-N | | SMILES | OC1CC(C1)(C(O)=O)c2ccc(Cl)cc2 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid Usage And Synthesis |
| | 1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid Preparation Products And Raw materials |
|