| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride
CAS:945375-77-9
Package:1G,250MG
|
| Company Name: |
Shanghai T&W Pharmaceutical Co., Ltd.
|
| Tel: |
+86 21 61551611 |
| Email: |
|
| Products Intro: |
Product Name:Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride
CAS:945375-77-9
Purity:98% Package:50kg;25kg;10kg;5kg;500g;500mg;
|
|
| | Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride, (A-caPhos)2PdCl2 Basic information |
| | Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride, (A-caPhos)2PdCl2 Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | InChI | 1S/2C20H32NP.2ClH.Pd/c2*1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19;;;/h2*13-16,18-19H,3-12H2,1-2H3;2*1H; | | InChIKey | ZVLBDYRPWSIJCO-UHFFFAOYSA-N | | SMILES | CN(C)c1ccc(cc1)[PH](C2CCCCC2)(C3CCCCC3)[Pd](Cl)(Cl)[PH](C4CCCCC4)(C5CCCCC5)c6ccc(cc6)N(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride, (A-caPhos)2PdCl2 Usage And Synthesis |
| reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| | Bis[(dicyclohexyl)(4-diMethylaMinophenyl)phosphine] palladiuM(II) chloride, (A-caPhos)2PdCl2 Preparation Products And Raw materials |
|