| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Benzaldehyde, 2-broMo-4-hydroxy Basic information |
| | Benzaldehyde, 2-broMo-4-hydroxy Chemical Properties |
| Boiling point | 292.4±20.0 °C(Predicted) | | density | 1.737±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.81±0.18(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C7H5BrO2/c8-7-3-6(10)2-1-5(7)4-9/h1-4,10H | | InChIKey | OCBOCCOUCDGNKX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(O)C=C1Br |
| | Benzaldehyde, 2-broMo-4-hydroxy Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 2-bromo-4-hydroxybenzaldehyde from ethanol and m-bromophenol was as follows: 30% aqueous sodium hydroxide solution (160 mL) was mixed with 3-bromophenol (10.04 g, 58 mmol) and heated to 70-75 °C. Subsequently, ethanol (5 mL) was added all at once and chloroform (28 mL, 0.35 mol) was added slowly and dropwise. After maintaining the reaction at 75 °C for 1 hour, the reaction mixture was continued to be stirred at this temperature for 3 hours. Upon completion of the reaction, the mixture was cooled to room temperature and acidified with 10N hydrochloric acid. Most of the by-products were removed by steam distillation. The residue was cooled and the precipitate was separated by filtration. The crude product was purified by silica gel column chromatography using hexane/ethyl acetate (2:1, v/v) as eluent to give 1.75 g of 2-bromo-4-hydroxybenzaldehyde in 15% yield. | | References | [1] Patent: WO2011/37731, 2011, A1. Location in patent: Page/Page column 111-112 |
| | Benzaldehyde, 2-broMo-4-hydroxy Preparation Products And Raw materials |
|