- CaCCinh-A01
-
- $52.00
-
2026-07-14
- CAS:407587-33-1
- Purity: 99.36%
- Supply Ability: 10g
|
| | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid Basic information |
| Product Name: | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid | | Synonyms: | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid;CaCCinh-A01;6-(1,1-Dimethylethyl)-2-[(2-furanylcarbonyl)amino]-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid;TMEM16 BLOCKER I;CaCC(inh)-A01, TMEM16 Blocker I.;CACCINH-A01; CACC(INH)-A01, TMEM16 BLOCKER I.;Benzo[b]thiophene-3-carboxylic acid, 6-(1,1-dimethylethyl)-2-[(2-furanylcarbonyl)amino]-4,5,6,7-tetrahydro-;CaCCinh-A01, 10 mM in DMSO | | CAS: | 407587-33-1 | | MF: | C18H21NO4S | | MW: | 347.43 | | EINECS: | | | Product Categories: | | | Mol File: | 407587-33-1.mol | ![6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid Structure](CAS/20180713/GIF/407587-33-1.gif) |
| | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid Chemical Properties |
| Boiling point | 429.7±45.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble20mg/mL, clear | | form | powder | | pka | 4.49±0.40(Predicted) | | color | white to beige | | InChI | 1S/C18H21NO4S/c1-18(2,3)10-6-7-11-13(9-10)24-16(14(11)17(21)22)19-15(20)12-5-4-8-23-12/h4-5,8,10H,6-7,9H2,1-3H3,(H,19,20)(H,21,22) | | InChIKey | ACLUEOBQFRYTQS-UHFFFAOYSA-N | | SMILES | [s]1c2c(c(c1NC(=O)c3[o]ccc3)C(=O)O)CCC(C2)C(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid Usage And Synthesis |
| Uses | CaCC(inh)-A01 is a potent, selective class A inhibitor of calcium-activated chloride channels (CaCCs). | | Biochem/physiol Actions | CaCCinh-A01 is a TMEM16A (transmembrane member 16A) inhibitor. It also blocks anoctamin-1 (ANO1) and decreases cell viability and represses cell migration. | | in vivo | CaCCinh-A01 (vein injection; 5 mg/kg; caudal vein injection within 15 min after the onset of reperfusion) significantly reduces infarction when compared with MCAO-saline treatment at 24 h or 72 h in middle cerebral artery occlusion model in mice[3]. | Animal Model: | Two-month-old male C57/BL6J mice[3] | | Dosage: | 5 mg/kg | | Administration: | Vein injection; 5 mg/kg; caudal vein injection within 15 min after the onset of reperfusion | | Result: | Attenuated brain infarct size, improved neurological outcomes and lowered BBB permeability after ischemic stroke in mice. |
| | storage | Store at -20°C |
| | 6-tert-butyl-2-(furan-2-carboxaMido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid Preparation Products And Raw materials |
|