- 2-Ethoxypropene
-
- $1.10 / 1g
-
2025-11-18
- CAS:926-66-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons min
- 2-Ethoxypropene
-
- $0.00 / 1KG
-
2025-06-27
- CAS:926-66-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 2-Ethoxypropene
-
- $5.00 / 1KG
-
2025-05-26
- CAS:926-66-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 2-Ethoxypropene Basic information |
| Product Name: | 2-Ethoxypropene | | Synonyms: | 2-ETHOXYPROPENE;2-ETHOXYPROPYLENE;ETHYL-ISO-PROPENYL ETHER;CH2=C(CH3)OC2H5;2-Ethoxy-1-propene;2-ETHYOXYPROPENE;2-ethoxyprop-1-ene;1-Propene, 2-ethoxy- | | CAS: | 926-66-9 | | MF: | C5H10O | | MW: | 86.13 | | EINECS: | 240-723-0 | | Product Categories: | | | Mol File: | 926-66-9.mol |  |
| | 2-Ethoxypropene Chemical Properties |
| Boiling point | 61.2-61.8 °C | | density | 0.771 | | solubility | Chloroform, Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless | | Stability: | Very Volatile | | InChI | InChI=1S/C5H10O/c1-4-6-5(2)3/h2,4H2,1,3H3 | | InChIKey | FSGHEPDRMHVUCQ-UHFFFAOYSA-N | | SMILES | C=C(OCC)C | | CAS DataBase Reference | 926-66-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Ethoxypropene(926-66-9) |
| | 2-Ethoxypropene Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Ethoxypropene is used in biological studies as bio-inspired synthetic nanovesicles for glucose-responsive release of insulin. |
| | 2-Ethoxypropene Preparation Products And Raw materials |
|