| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(±)-trans-1,3-Diphenylallyl acetate manufacturers
|
| | (±)-trans-1,3-Diphenylallyl acetate Basic information |
| Product Name: | (±)-trans-1,3-Diphenylallyl acetate | | Synonyms: | (+/-)-trans-1,3-Diphenylallyl acetate 97%;Acetic acid trans-1,3-diphenylallyl ester;(±)-trans-1,3-Diphenylallyl acetate;Benzenemethanol, α-[(1E)-2-phenylethenyl]-, 1-acetate;(+/-)-trans-1,3-Diphenylallyl acetate;Acetic acid，1，3-Diphenylallyl ester;(±)-trans-1,3-Diphenylallyl acetate;(±)-trans-1,3-Diphenylallyl acetate | | CAS: | 87751-69-7 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | | | Mol File: | 87751-69-7.mol |  |
| | (±)-trans-1,3-Diphenylallyl acetate Chemical Properties |
| Boiling point | 386.0±21.0 °C(Predicted) | | density | 1.104±0.06 g/cm3(Predicted) | | form | liquid | | BRN | 3610772 | | InChI | 1S/C17H16O2/c1-14(18)19-17(16-10-6-3-7-11-16)13-12-15-8-4-2-5-9-15/h2-13,17H,1H3/b13-12+ | | InChIKey | UVJZGFKZGQSKDV-OUKQBFOZSA-N | | SMILES | CC(=O)OC(\C=C\c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (±)-trans-1,3-Diphenylallyl acetate Usage And Synthesis |
| | (±)-trans-1,3-Diphenylallyl acetate Preparation Products And Raw materials |
|