| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1,2,3-Benzenetricarboxylic acid hydrate manufacturers
|
| | 1,2,3-Benzenetricarboxylic acid hydrate Basic information |
| | 1,2,3-Benzenetricarboxylic acid hydrate Chemical Properties |
| Melting point | ca 191℃ | | form | solid | | Water Solubility | Slightly soluble in water. | | BRN | 2214816 | | InChI | 1S/C9H6O6.H2O/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;/h1-3H,(H,10,11)(H,12,13)(H,14,15);1H2 | | InChIKey | DYDNZUYNRZENMU-UHFFFAOYSA-N | | SMILES | O.OC(=O)c1cccc(C(O)=O)c1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,3-Benzenetricarboxylic acid hydrate Usage And Synthesis |
| Uses | It is used in the synthesis and characterization and thermal behavior of hemimellitic acid complexes with lanthanides(III). |
| | 1,2,3-Benzenetricarboxylic acid hydrate Preparation Products And Raw materials |
|