|
|
| | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester Basic information |
| Product Name: | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester | | Synonyms: | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester;pyridine-2,4-dicarboxylic acid 2-Methyl ester;2-(Methoxycarbonyl)isonicotinic acid;pyridine-2,4-dicarboxylic acid 2-methyl este;2-(METHOXYCARBONYL)PYRIDINE-4-CARBOXYLIC ACID;Topiroxostat Impurity 52;Tuobisite Impurity 22 | | CAS: | 24195-10-6 | | MF: | C8H7NO4 | | MW: | 181.15 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 24195-10-6.mol |  |
| | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester Chemical Properties |
| Melting point | 244-246 °C(Solv: water (7732-18-5)) | | Boiling point | 440.6±30.0 °C(Predicted) | | density | 1.361±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.00±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7NO4/c1-13-8(12)6-4-5(7(10)11)2-3-9-6/h2-4H,1H3,(H,10,11) | | InChIKey | MAFJOMAYYKSZOS-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC=CC(C(O)=O)=C1 |
| | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester Usage And Synthesis |
| | 2,4-Pyridinedicarboxylic acid, 2-Methyl ester Preparation Products And Raw materials |
|