|
|
| | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate Basic information |
| Product Name: | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate | | Synonyms: | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate;1,2,4,5-Cyclohexanetetracarboxylic acid tetramethyl ester;Tetramethyl hexahydropyromellitate;1,2,4,5-Cyclohexanetetracarboxylic acid, 1,2,4,5-tetramethyl ester | | CAS: | 92298-55-0 | | MF: | C14H20O8 | | MW: | 316.3 | | EINECS: | | | Product Categories: | | | Mol File: | 92298-55-0.mol |  |
| | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate Chemical Properties |
| Boiling point | 388.7±37.0 °C(Predicted) | | density | 1.231 | | InChI | InChI=1S/C14H20O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h7-10H,5-6H2,1-4H3 | | InChIKey | WXORPFRDBYGNKY-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)CC(C(OC)=O)C(C(OC)=O)CC1C(OC)=O |
| | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate Usage And Synthesis |
| Uses | Tetramethyl cyclohexane-1,2,4,5-tetracarboxylate is a chemical compound that can be used as a starting material or intermediate in organic synthesis. It can also be used as a building block in the production of various compounds, such as polymers and pharmaceuticals. |
| | tetraMethyl cyclohexane-1,2,4,5-tetracarboxylate Preparation Products And Raw materials |
|