Amma-chlorocrotonicacid manufacturers
|
| | Amma-chlorocrotonicacid Basic information |
| Product Name: | Amma-chlorocrotonicacid | | Synonyms: | 4-Chlorobut-2-enoic acid;2-Butenoic acid, 4-chloro-;4-Chloro-2-butenoic Acid;(E)-4-chlorobut-2-enoicaci;(2E)-4-chlorobut-2-enoic acid;GAMMA-CHLOROCROTONIC ACID;Amma-chlorocrotonicacid | | CAS: | 16197-90-3 | | MF: | C4H5ClO2 | | MW: | 120.53 | | EINECS: | | | Product Categories: | | | Mol File: | 16197-90-3.mol |  |
| | Amma-chlorocrotonicacid Chemical Properties |
| Melting point | 83°C | | Boiling point | 148.96°C (rough estimate) | | density | 1.2094 (rough estimate) | | refractive index | 1.4704 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 4.17±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H5ClO2/c5-3-1-2-4(6)7/h1-2H,3H2,(H,6,7) | | InChIKey | TVOMCUWVZVBDBG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CCCl |
| | Amma-chlorocrotonicacid Usage And Synthesis |
| Uses | 4-Chloro-2-butenoic Acid is used in the organic synthesis of more complex compounds. |
| | Amma-chlorocrotonicacid Preparation Products And Raw materials |
|