| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Diethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,4-dicarboxylate
|
| Company Name: |
OTAVA chemicals
|
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
| Products Intro: |
Product Name:3,4-diethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,4-dicarboxylate
Package:1000mg
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:AldrichCPR
|
| Company Name: |
Butt Park Ltd.
|
| Tel: |
44 (1761)-435170 |
| Email: |
113707.50@compuserve.com |
| Products Intro: |
|
|
| | BUTTPARK 126\48-77 Basic information |
| Product Name: | BUTTPARK 126\48-77 | | Synonyms: | BUTTPARK 126\48-77;Diethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,4-dicarboxylate | | CAS: | | | MF: | C14H19NO4S | | MW: | 297.37 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | BUTTPARK 126\48-77 Chemical Properties |
| form | solid | | InChI | 1S/C14H19NO4S/c1-3-18-13(16)8-6-5-7-9-10(8)11(12(15)20-9)14(17)19-4-2/h8H,3-7,15H2,1-2H3 | | InChIKey | FEIDYTOTIZOYOH-UHFFFAOYSA-N | | SMILES | [s]1c2c(c(c1N)C(=O)OCC)C(CCC2)C(=O)OCC |
| Storage Class | 11 - Combustible Solids |
| | BUTTPARK 126\48-77 Usage And Synthesis |
| | BUTTPARK 126\48-77 Preparation Products And Raw materials |
|