|
|
| | N-TRIDECANOPHENONE Basic information |
| Product Name: | N-TRIDECANOPHENONE | | Synonyms: | N-DODECYL PHENYL KETONE;N-TRIDECANOPHENONE;Tridecanophenone;Dodecyl Phenyl Ketone;1-Phenyl-1-tridecanone;1-Phenyltridecane-1-one;1-Tridecanone, 1-phenyl-;1-Phenyltridecan-1-one | | CAS: | 6005-99-8 | | MF: | C19H30O | | MW: | 274.44 | | EINECS: | | | Product Categories: | | | Mol File: | 6005-99-8.mol |  |
| | N-TRIDECANOPHENONE Chemical Properties |
| Melting point | 42 °C | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C19H30O/c1-2-3-4-5-6-7-8-9-10-14-17-19(20)18-15-12-11-13-16-18/h11-13,15-16H,2-10,14,17H2,1H3 | | InChIKey | ZZNDQCACFUJAKJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCCCCC | | CAS DataBase Reference | 6005-99-8 |
| | N-TRIDECANOPHENONE Usage And Synthesis |
| | N-TRIDECANOPHENONE Preparation Products And Raw materials |
|