|
|
| | Fmoc-3-(4-pyridyl)-L-alanine Basic information |
| Product Name: | Fmoc-3-(4-pyridyl)-L-alanine | | Synonyms: | Fmoc-L-3-(4-Pyridyl);FMOC-(S)-2-AMINO-3-(4'-PYRIDYL)PROPANOIC ACID;FMOC-3-(4'-PYRIDYL)-L-ALANINE;FMOC-3-(4-PYRIDYL)-L-ALANINE;FMOC-3-(4-PYRIDINYL)ALANINE;FMOC-4'-PYRIDYL-L-ALA;FMOC-4-PAL-OH;FMOC-ALA(4-PYRI)-OH | | CAS: | 169555-95-7 | | MF: | C23H20N2O4 | | MW: | 388.42 | | EINECS: | | | Product Categories: | Amino Acids;a-amino | | Mol File: | 169555-95-7.mol |  |
| | Fmoc-3-(4-pyridyl)-L-alanine Chemical Properties |
| Melting point | 219 °C(dec.) | | Boiling point | 646.9±55.0 °C(Predicted) | | density | 1.309±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in 0.1g in 4mL DMF(clearly soluble). | | pka | 3.32±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Optical Rotation | -46.0° (C=1.00 g/100ml, DMF) | | BRN | 7316905 | | InChI | InChI=1/C23H20N2O4/c26-22(27)21(13-15-9-11-24-12-10-15)25-23(28)29-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/s3 | | InChIKey | SCSSXJVRZMQUKA-DLINEHSKNA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=NC=C1)NC(OCC1C2C(=CC=CC=2)C2C1=CC=CC=2)=O |&1:3,r| | | CAS DataBase Reference | 169555-95-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | Fmoc-3-(4-pyridyl)-L-alanine Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | Fmoc-?-(4-pyridyl)-Ala-OH is potentially useful for solid phase peptide synthesis techniques. |
| | Fmoc-3-(4-pyridyl)-L-alanine Preparation Products And Raw materials |
|