|
|
| | 3-NITRO-1,8-NAPHTHALIC ANHYDRIDE Basic information |
| Product Name: | 3-NITRO-1,8-NAPHTHALIC ANHYDRIDE | | Synonyms: | 1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 5-nitro-;3h-naphtho(1,8-cd)pyran-1,3-dione,5-nitro-1;3-Nitronaphthalic anhydride;3-nitro-naphthalicanhydrid;5-Nitro-1H,3H-benzo[de]isochromene-1,3-dione;Naphthalic anhydride, 3-nitro-;3-NITRO-1,8-NAPHTHALIC ANHYDRIDE;3-NITRO-1,8-NAPHTHALIC ANHYDRIDE, TECH. | | CAS: | 3027-38-1 | | MF: | C12H5NO5 | | MW: | 243.17 | | EINECS: | 629-274-5 | | Product Categories: | Phthalic Acids, Esters and Derivatives | | Mol File: | 3027-38-1.mol |  |
| | 3-NITRO-1,8-NAPHTHALIC ANHYDRIDE Chemical Properties |
| Melting point | 247-249 °C (dec.) (lit.) | | Boiling point | 386.04°C (rough estimate) | | density | 1.4429 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Powder | | color | Light yellow to beige or light brown | | BRN | 23762 | | InChI | InChI=1S/C12H5NO5/c14-11-8-3-1-2-6-4-7(13(16)17)5-9(10(6)8)12(15)18-11/h1-5H | | InChIKey | FLFLZYYDLIKGJQ-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=CC([N+]([O-])=O)=CC3=C2C1=CC=C3 | | CAS DataBase Reference | 3027-38-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | QK5370000 | | F | 10-21 | | HazardClass | IRRITANT | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-NITRO-1,8-NAPHTHALIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | Light yellow to beige or light brown powder | | Uses | 3-Nitro-1,8-naphthalic anhydride is a reagent used to synthesize a monoboronic acid fluorescent sensor that exhibits emission suitable for ratiometric testing and also displays sensitivity for glucose relative to fructose and galactose. 3-Nitro-1,8-naphthalic anhydride is also used as a starting reagent in the synthesis of 5-substituted naphthalimide derivatives which exhibit high anti-cancer activity. |
| | 3-NITRO-1,8-NAPHTHALIC ANHYDRIDE Preparation Products And Raw materials |
|