|
|
| | 4-((diMethylaMino)Methyl)-3-fluorophenylboronic acid Basic information |
| | 4-((diMethylaMino)Methyl)-3-fluorophenylboronic acid Chemical Properties |
| Boiling point | 298.2±50.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 7.29±0.18(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C9H13BFNO2/c1-12(2)6-7-3-4-8(10(13)14)5-9(7)11/h3-5,13-14H,6H2,1-2H3 | | InChIKey | BZGKUSJVFIQRST-UHFFFAOYSA-N | | SMILES | B(O)(O)c1cc(c(cc1)CN(C)C)F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-((diMethylaMino)Methyl)-3-fluorophenylboronic acid Usage And Synthesis |
| | 4-((diMethylaMino)Methyl)-3-fluorophenylboronic acid Preparation Products And Raw materials |
|