|
|
| | 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3-BUTANEDIONE Basic information |
| Product Name: | 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3-BUTANEDIONE | | Synonyms: | 4,4,4-trifluoro-1-(2-naphthalenyl)-3-butanedione;TIMTEC-BB SBB003067;NAPHTHOYLTRIFLUOROACETONE;1-(2-NAPHTHOYL)-3,3,3-TRIFLUOROACETONE;2-(4,4,4-TRIFLUOROACETOACETYL)NAPHTHALENE;3-(2'-NAPHTHOYL)-1,1,1-TRIFLUOROACETONE;3-(2-NAPHTHOYL)-1,1,1-TRIFLUOROACETONE;2-(TRIFLUOROACETOACETYL)NAPHTHALENE | | CAS: | 893-33-4 | | MF: | C14H9F3O2 | | MW: | 266.22 | | EINECS: | | | Product Categories: | | | Mol File: | 893-33-4.mol |  |
| | 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3-BUTANEDIONE Chemical Properties |
| Melting point | 70-72 °C(lit.) | | Boiling point | 350.7±37.0 °C(Predicted) | | density | 1.3216 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMF: soluble | | pka | 7.70±0.50(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | BRN | 1981085 | | InChI | InChI=1S/C14H9F3O2/c15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 | | InChIKey | WVVLURYIQCXPIV-UHFFFAOYSA-N | | SMILES | C(C1=CC=C2C(=C1)C=CC=C2)(=O)CC(=O)C(F)(F)F | | CAS DataBase Reference | 893-33-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Butanedione, 4,4,4-trifluoro-1-(2-naphthalenyl)- (893-33-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10-23 | | TSCA | T | | HazardClass | IRRITANT | | HS Code | 29143990 |
| | 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3-BUTANEDIONE Usage And Synthesis |
| Chemical Properties | beige crystals or crystalline powder | | Uses | 4,4,4-Trifluoro-3-oxo-2''-butyronaphthone is a useful fluorescent compound. | | Purification Methods | Crystallise the dione from EtOH. The mono oxime crystallises from H2O or aqueous EtOH and has m 137-138o. [Reid & Calvin J Am Chem Soc |
| | 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3-BUTANEDIONE Preparation Products And Raw materials |
|