|
|
| | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole Basic information |
| Product Name: | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole | | Synonyms: | 2,2'-(phenylmethylene)bis-1H-Pyrrole;5-PHENYLDIPYRROMETHANE;1H-Pyrrole, 2,2'-(phenylmethylene)bis-;2,2’-(Phenylmethylene)bispyrrole;2,2'-(phenylmethylene)bis(1H-pyridine);2,2'-(Phenylmethylene)bis(1H-pyrrole);2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole | | CAS: | 107798-98-1 | | MF: | C15H14N2 | | MW: | 222.29 | | EINECS: | | | Product Categories: | Porphyrins | | Mol File: | Mol File | ![2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole Structure](StructureFile/ChemBookStructure4/GIF/CB2269210.gif) |
| | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole Chemical Properties |
| Melting point | 100-101 °C | | Boiling point | 414.9±35.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 16.93±0.50(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C15H14N2/c1-2-6-12(7-3-1)15(13-8-4-10-16-13)14-9-5-11-17-14/h1-11,15-17H | | InChIKey | ODOQKWUKLACHRO-UHFFFAOYSA-N | | SMILES | C(C1=CC=CN1)(C1=CC=CN1)C1=CC=CC=C1 |
| | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole Usage And Synthesis |
| Uses | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole is a useful chemical in the study of electrochemical CO2 reduction with iron tetraphenylporphyrin. | | Synthesis Reference(s) | Tetrahedron Letters, 35, p. 2455, 1994 DOI: 10.1016/S0040-4039(00)77142-5 |
| | 2-[Phenyl(1H-pyrrol-2-yl)methyl]-1H-pyrrole Preparation Products And Raw materials |
|