|
|
| | 7,11-Diethyl-10-hydroxycaMptothecin Basic information |
| Product Name: | 7,11-Diethyl-10-hydroxycaMptothecin | | Synonyms: | Irinotecan EP Impurity G;IRINOTECAN EP IMPURITY G (7,11-DIETHYL-10-HYDROXY CAMPTOTHECIN);(S)-4,8,11-Triethyl-4,9-dihydroxy-1H-pyrano[3’,4’:6,7]indolizino[1,2-b]quinoline-3,14-(4H,12H)-dione;(S)-4,8,11-triethyl-4,9-dihydroxy-;1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 4,8,11-triethyl-4,9-dihydroxy-, (4S)-;(S)-4,8,11-triethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione? (Irinotecan Impurity);Irinotecan EP Impurity G/ Irinotecan Related Compound G (7,11-Diethyl-10-hydroxycamptothecin/ 8,11-Diethyl-9-Hydroxy Camptothecin);(4S)-4,8,11-Triethyl-4,9-dihydroxy-1H-pyrano[3'',4'':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione | | CAS: | 947687-01-6 | | MF: | C24H24N2O5 | | MW: | 420.46 | | EINECS: | | | Product Categories: | Aromatics, Heterocycles, Impurities, Inhibitors, Isotope Labelled Compounds, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 947687-01-6.mol |  |
| | 7,11-Diethyl-10-hydroxycaMptothecin Chemical Properties |
| Boiling point | 798.1±60.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture and light | | solubility | DMSO (Slightly, Heated) | | form | Solid | | pka | 9.43±0.40(Predicted) | | color | Light Yellow to Yellow | | InChI | InChI=1S/C24H24N2O5/c1-4-12-7-18-14(8-20(12)27)13(5-2)15-10-26-19(21(15)25-18)9-17-16(22(26)28)11-31-23(29)24(17,30)6-3/h7-9,27,30H,4-6,10-11H2,1-3H3/t24-/m0/s1 | | InChIKey | BQAJEBSARMNUPK-DEOSSOPVSA-N | | SMILES | N1C2C(=CC(O)=C(CC)C=2)C(CC)=C2CN3C(C=12)=CC1[C@](CC)(O)C(=O)OCC=1C3=O |
| | 7,11-Diethyl-10-hydroxycaMptothecin Usage And Synthesis |
| Uses | 7,11-Diethyl-10-hydroxycamptothecin is an impurity of the DNA topoisomerase inhibitor Irinotecan (I767500). |
| | 7,11-Diethyl-10-hydroxycaMptothecin Preparation Products And Raw materials |
|