|
|
| | 2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol Basic information |
| Product Name: | 2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol | | Synonyms: | (3R,4R)-3-AMino-4-hydroxy-tetrahydropyran;(3R,4R)-3-aminooxan-4-ol;2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentito;2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol;(3R,4R)-3-Amino-tetrahydro-pyran-4-ol;CPD3200;D-threo-Pentitol, 2-amino-1,5-anhydro-2,4-dideoxy- | | CAS: | 1350734-61-0 | | MF: | C5H11NO2 | | MW: | 117.15 | | EINECS: | | | Product Categories: | Heterocycles, Miscellaneous Reagents | | Mol File: | 1350734-61-0.mol |  |
| | 2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol Chemical Properties |
| Boiling point | 246.8±40.0 °C(Predicted) | | density | 1.147±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 14.25±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C5H11NO2/c6-4-3-8-2-1-5(4)7/h4-5,7H,1-3,6H2/t4-,5-/s3 | | InChIKey | KUCSFTQJADYIQH-GADJSHNENA-N | | SMILES | N[C@@H]1COCC[C@H]1O |&1:1,6,r| |
| | 2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol Usage And Synthesis |
| Uses | 2-Amino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol is used in the preparation of ERR-α inverse agonists as an agent for the treatment of cancer. |
| | 2-AMino-1,5-anhydro-2,4-dideoxy-D-threo-pentitol Preparation Products And Raw materials |
|