- Morellic acid
-
- $83.00 / 1mg
-
2026-03-13
- CAS:5304-71-2
- Min. Order:
- Purity: 99.85%
- Supply Ability: 10g
|
| | Morellic acid Basic information |
| Product Name: | Morellic acid | | Synonyms: | Morellic acid;2-Butenoic acid, 2-methyl-4-[(1R,3aS,5S,14aS)-3a,4,5,7-tetrahydro-8-hydroxy-3,3,11,11-tetramethyl-13-(3-methyl-2-buten-1-yl)-7,15-dioxo-1,5-methano-1H,3H,11H-furo[3,4-g]pyrano[3,2-b]xanthen-1-yl]-, (2Z)-;Morellic acid,cell,antiangiogenic,inhibit,Inhibitor,HUVEC;(Z)-4-((1S,3aR,5S,14aS)-8-Hydroxy-2,2,11,11-tetramethyl-13-(3-methylbut-2-en-1-yl)-4,7-dioxo-2,3a,4,5,7,11-hexahydro-1H-1,5-methanofuro[3,2-g]pyrano[3,2-b]xanthen-3a-yl)-2-methylbut-2-enoic acid;(-)-Morellic Acid;Morellic acid-RM;Morellic acid, 10 mM in DMSO | | CAS: | 5304-71-2 | | MF: | C33H36O8 | | MW: | 560.63 | | EINECS: | | | Product Categories: | | | Mol File: | 5304-71-2.mol |  |
| | Morellic acid Chemical Properties |
| Melting point | 94℃ | | Boiling point | 777.6±60.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in chloroform and DMSO | | form | Powder | | pka | 4.58±0.36(Predicted) | | color | Orange to red | | InChI | 1S/C29H31N3O2/c1-21-8-13-28-25(18-21)27-19-26(23-9-11-24(33-2)12-10-23)30-32(27)29(34-28)14-16-31(17-15-29)20-22-6-4-3-5-7-22/h3-13,18,27H,14-17,19-20H2,1-2H3 | | InChIKey | XYTOZJVLVMHAAC-UHFFFAOYSA-N | | SMILES | CC(C=C1)(C)OC2=C1C(O)=C(C(C([C@@]34[C@@]5(C/C=C(C(O)=O)/C)OC(C)([C@@]4(C6)[H])C)=C[C@@]6([H])C5=O)=O)C(O3)=C2CC=C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Morellic acid Usage And Synthesis |
| Chemical Properties | White crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the resin of Garcinia hanburyi Hook.f., a plant of the Garcinia family. | | Uses | Morellic Acid is used as a protein tyrosine phosphatase 1B (PTP1B) inhibitor in the treatment of diabetes or cancer. | | target | HIV | Antifection |
| | Morellic acid Preparation Products And Raw materials |
|