| Company Name: |
Tocopharm Co., Ltd. |
| Tel: |
+86-021-69895597 13776836200 +86-13776836200 |
| Email: |
tocopharm@gmail.com |
|
| | 4-oxa-7-azaspiro[2.5]octan-6-one Basic information |
| | 4-oxa-7-azaspiro[2.5]octan-6-one Chemical Properties |
| Boiling point | 353.9±35.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 15.02±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H9NO2/c8-5-3-9-6(1-2-6)4-7-5/h1-4H2,(H,7,8) | | InChIKey | ZCAHJGUQWHVUJE-UHFFFAOYSA-N | | SMILES | C1C2(CNC(=O)CO2)C1 |
| | 4-oxa-7-azaspiro[2.5]octan-6-one Usage And Synthesis |
| | 4-oxa-7-azaspiro[2.5]octan-6-one Preparation Products And Raw materials |
|