[1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl manufacturers
|
| | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl Basic information |
| Product Name: | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl | | Synonyms: | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl;(+/-) -rac-N,N'-Dimethyl-1,1'-binaphthyldiamine;N-methyl-1-[2-(methylamino)naphthalen-1-yl]naphthalen-2-amine;N,N'-Dimethyl-2,2'-diamino-1,1'-binaphthyl;N,N'-Dimethyl-2,2'-diamino-1,1'-binaphthy;[1,1'-Binaphthalene]-2,2'-diamine, N2,N2'-dimethyl-;(+/-) -rac-N,N’-Dimethyl-1,1’-binaphthyldiamine;N2,N2' -dimethyl -[1,1' -binaphthalene]-2,2' -diamine | | CAS: | 93621-64-8 | | MF: | C22H20N2 | | MW: | 312.41 | | EINECS: | | | Product Categories: | | | Mol File: | 93621-64-8.mol | ![[1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl Structure](CAS/20200331/GIF/93621-64-8.gif) |
| | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl Chemical Properties |
| Melting point | 146-148 °C | | Boiling point | 516.1±45.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.89±0.40(Predicted) | | InChI | InChI=1S/C22H20N2/c1-23-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)24-2/h3-14,23-24H,1-2H3 | | InChIKey | PXDKDUXMEHPNCO-UHFFFAOYSA-N | | SMILES | C1(C2=C3C(C=CC=C3)=CC=C2NC)=C2C(C=CC=C2)=CC=C1NC |
| | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl Usage And Synthesis |
| | [1,1'-Binaphthalene]-2,2'-diamine, N,N'-dimethyl Preparation Products And Raw materials |
|