- Mupirocin EP Impurity F
-
- $0.00 / 10mg
-
2025-07-31
- CAS:167842-64-0
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | PseudoMonic Acid F Basic information |
| Product Name: | PseudoMonic Acid F | | Synonyms: | PseudoMonic Acid F;MIVFEJHUAUQOLX-XUUZYBQDSA-N;Mupirocin Calcium Impurity 6(Mupirocin Calcium EP Impurity F);Mupirocin Calcium EP Impurity F;Mupirocin EP Impurity F/Pseudomonic Acid F/7-[[(2E)-4-[(2S,3R,4R,5S)-3,4-Dihydroxy-5-[[(2S,3S)-3-[(1S, 2S)-2-hydroxy-1-methylpropyl]oxiranyl]methyl]tetrahydro2H-pyran-2-yl]-3-methylbut-2-enoyl]oxy]heptanoic acid;7-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxyheptanoic acid;Mupirocin Calcium Impurity F;L-talo-Non-2-enonic acid, 5,9-anhydro-2,3,4,8-tetradeoxy-8-[[(2S,3S)-3-[(1S,2S)-2-hydroxy-1-methylpropyl]-2-oxiranyl]methyl]-3-methyl-, 6-carboxyhexyl ester, (2E)- | | CAS: | 167842-64-0 | | MF: | C24H40O9 | | MW: | 472.58 | | EINECS: | | | Product Categories: | | | Mol File: | 167842-64-0.mol |  |
| | PseudoMonic Acid F Chemical Properties |
| Boiling point | 656.0±55.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | pka | 4.76±0.10(Predicted) | | InChIKey | MIVFEJHUAUQOLX-GKYZIWFUNA-N | | SMILES | C([C@@]1([H])CO[C@@H](C/C(/C)=C/C(=O)OCCCCCCC(=O)O)[C@H](O)[C@@H]1O)[C@@H]1O[C@@]1([H])[C@@H](C)[C@@H](O)C |&1:1,5,22,24,26,28,30,32,r| |
| | PseudoMonic Acid F Usage And Synthesis |
| Uses | Pseudomonic Acid F, is the analogue of Pseudomonic Acid D (P839520) which is an antibiotic isolated from Pseudomonas fluorescens. |
| | PseudoMonic Acid F Preparation Products And Raw materials |
|