- Sibiricose A6
-
- $31.00 / 1mg
-
2026-01-21
- CAS:241125-75-7
- Min. Order:
- Purity: 99.09%
- Supply Ability: 10g
- Sibiricose A6
-
- $0.00 / 5mg
-
2023-02-24
- CAS:241125-75-7
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Sibiricose A6 Basic information |
| Product Name: | Sibiricose A6 | | Synonyms: | Sibiricose A6;3-O-[(2E)-3-(4-Hydroxy-3,5-dimethoxyphenyl)-1-oxo-2-propenyl]-beta-D-fructofuranosyl alpha-D-glucopyranoside;α-D-Glucopyranoside, 3-O-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-oxo-2-propen-1-yl]-β-D-fructofuranosyl;Sibiricose Impurity 1;Sibiricose A6-RM;Sibiricose A6, 10 mM in DMSO | | CAS: | 241125-75-7 | | MF: | C23H32O15 | | MW: | 548.49 | | EINECS: | | | Product Categories: | Phenylpropanoids | | Mol File: | 241125-75-7.mol |  |
| | Sibiricose A6 Chemical Properties |
| Boiling point | 837.3±65.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | form | solid | | pka | 9.75±0.36(Predicted) | | InChIKey | WTCVROXOIQEIRC-IBVGEFGBSA-N | | SMILES | O1[C@]([C@H]([C@@H]([C@H]1CO)O)OC(=O)\C=C\c3cc(c(c(c3)OC)O)OC)(O[C@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Sibiricose A6 Usage And Synthesis |
| Chemical Properties | It is soluble in organic solvents such as methanol, ethanol, and DMSO. It comes from the plant Polygala tenuifolia of the Polygalaceae family, also known as Polygala dasyphylla. | | Uses | Sibiricose A6 is a component of Polygala Tenuifolia and is used in traditional Chinese medicine. Potential antidepressant. |
| | Sibiricose A6 Preparation Products And Raw materials |
|