| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:8(14)-dehydrocholesterol CAS:177962-82-2 Purity:cholesta-5,8(14)-dien-3beta-ol, powder Package:1MG Remarks:700076P-1MG
|
| Company Name: |
Codow Chemical Co.,Ltd.
|
| Tel: |
18620099427 |
| Email: |
amy@howeipharm.com |
| Products Intro: |
Product Name:cholesta-5,8(14)-dien-3?-ol CAS:177962-82-2 Purity:>95% Package:1MG;2.5MG
|
|
| | cholesta-5,8(14)-dien-3-ol Basic information |
| Product Name: | cholesta-5,8(14)-dien-3-ol | | Synonyms: | cholesta-5,8(14)-dien-3-ol;8(14)-dehydrocholesterol;CHOLESTA-5,8(14)-DIEN-3-OL;8(14)-DEHYDROCHOLESTEROL;Cholesta-5,8(14)-dien-3-ol, (3β)-;Cholesterol-5,8 (14) - diene-3- alcohol;Cholesterin-5,8(14) -diene-3? -alcohol;cholesta-5,8(14)-dien-3β-ol | | CAS: | 177962-82-2 | | MF: | C27H44O | | MW: | 384.63766 | | EINECS: | | | Product Categories: | | | Mol File: | 177962-82-2.mol |  |
| | cholesta-5,8(14)-dien-3-ol Chemical Properties |
| Boiling point | 494.1±44.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | -70°C | | pka | 15.01±0.70(Predicted) | | form | powder | | InChIKey | DJNCIOAUQVURTQ-KVMRZRRHSA-N | | SMILES | C[C@@]12C(CCC2C(CCCC(C)C)C)=C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC1 |
| Storage Class | 11 - Combustible Solids |
| | cholesta-5,8(14)-dien-3-ol Usage And Synthesis |
| Uses | 8(14)-Dehydrocholesterol is used in biochemical methods to analyze unsaturated C27 sterols by gas chromatography and mass spectrometry from an updated look. | | Biochem/physiol Actions | 8(14)-dehydrocholesterol is a cholestadienol. The free radical oxidation leads to abstraction of hydrogen at the bis-allylic positions leading to formation of D7-3,5-dihydroxycholest-7-en-6-one (DHCEO). |
| | cholesta-5,8(14)-dien-3-ol Preparation Products And Raw materials |
|