|
|
| | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester Basic information |
| Product Name: | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester | | Synonyms: | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester;2-methyl-acrylic acid 2-oxo-[1,3]-dioxolan-4-ylmethyl ester;(2-OXO-1,3-DIOXOLAN-4-YL)METHYL METHACRYLATE;2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl;4-(Hydroxymethyl)-1,3-dioxolan-2-one methacrylate;(2-oxo-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate;(2-Oxo-1,3-dioxolan-4-yl)methyl Methacrylate (stabilized with MEHQ);Methacrylic Acid (2-Oxo-1,3-dioxolan-4-yl)methyl Ester | | CAS: | 13818-44-5 | | MF: | C8H10O5 | | MW: | 186.16 | | EINECS: | 202-980-7 | | Product Categories: | | | Mol File: | 13818-44-5.mol |  |
| | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester Chemical Properties |
| Boiling point | 112-132 °C(Press: 0.06 Torr) | | density | 1.218±0.06 g/cm3(Predicted) | | refractive index | 1.47 | | storage temp. | 2-8°C, stored under nitrogen | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | InChI=1S/C8H10O5/c1-5(2)7(9)11-3-6-4-12-8(10)13-6/h6H,1,3-4H2,2H3 | | InChIKey | NUTJVZGIRRFKKI-UHFFFAOYSA-N | | SMILES | C(OCC1COC(=O)O1)(=O)C(C)=C | | CAS DataBase Reference | 13818-44-5 |
| TSCA | TSCA listed | | HS Code | 2916.14.2050 |
| | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester Usage And Synthesis |
| | 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester Preparation Products And Raw materials |
|