|
|
| | 3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid Basic information |
| Product Name: | 3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid | | Synonyms: | Obeticholic Acid Intermediate G;Intermediate 3;3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid;3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid-o;(3alpha,5beta,6alpha)-6-Ethyl-3-hydroxy-7-oxocholan-24-oic acid;(3α,5β,6α)--6-Ethyl-3-hydroxy-7-oxocholan-24-oic acid;Obeticholic acid intermediate 4;(3α,5β,6α)-6-ethyl-3-hydroxy-7-oxo-cholan-24-oic acid (BTC-B1) | | CAS: | 915038-26-5 | | MF: | C26H42O4 | | MW: | 418.62 | | EINECS: | 1592732-453-0 | | Product Categories: | Ocaliva intermediate;915038-26-5 | | Mol File: | 915038-26-5.mol |  |
| | 3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid Chemical Properties |
| Boiling point | 561.5±25.0 °C(Predicted) | | density | 1.087±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Dichloromethane; Chloroform; Ethyl Acetate; DMSO; Methanol; | | pka | 4.76±0.10(Predicted) | | form | Solid | | color | White | | InChIKey | LHSZAKRHUYJKIU-MLQOAFOQNA-N | | SMILES | C[C@]12CC[C@@H](O)C[C@@]1([H])[C@@H](CC)C(=O)[C@@]1([H])[C@]3([H])CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@]21[H] |&1:1,4,7,9,14,16,20,22,29,33,r| |
| | 3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid Usage And Synthesis |
| Uses | (3α,5β,6α)-6-Ethyl-3-hydroxy-7-oxo-cholan-24-oic Acid is an intermediate used in the synthesis of 6α-Ethyl Ursodeoxycholic Acid (E932095), which is an epimer of Obeticholic Acid (E899810). Obeticholic Acid is a derivative of the bile acid Chenodeoxycholic Acid (C291900). Obeticholic Acid is a potent activator of the farnesoid X nuclear receptor which reduces liver fat and fibrosis in animal models of fatty liver disease. |
| | 3α-hydroxy-6-ethyl-7-keto-5β-cholan-24-oic acid Preparation Products And Raw materials |
|