|
|
| | 3-Bromo-4'-chloro-1,1'-biphenyl Basic information |
| Product Name: | 3-Bromo-4'-chloro-1,1'-biphenyl | | Synonyms: | 3-Bromo-4'-chloro-1,1'-biphenyl;1,1'-Biphenyl, 3-bromo-4'-chloro-;1-bromo-3-(4-chlorophenyl)benzene;3-Bromo-4'-
chlorobiphenyl;3-Bromo-4'-chlorobiphenyl 98%min | | CAS: | 164334-69-4 | | MF: | C12H8BrCl | | MW: | 267.55 | | EINECS: | | | Product Categories: | | | Mol File: | 164334-69-4.mol |  |
| | 3-Bromo-4'-chloro-1,1'-biphenyl Chemical Properties |
| Boiling point | 328.4±17.0 °C(Predicted) | | density | 1.463±0.06 g/cm3(Predicted) | | refractive index | 1.66 | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C12H8BrCl/c13-11-3-1-2-10(8-11)9-4-6-12(14)7-5-9/h1-8H | | InChIKey | HUHYFZSUBKNCJM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Cl)C=C2)=CC=CC(Br)=C1 |
| | 3-Bromo-4'-chloro-1,1'-biphenyl Usage And Synthesis |
| Uses | 3-Bromo-4'-chloro-1,1'-biphenyl is a hydrocarbon organic matter and can be used as pharmaceutical intermediates. |
| | 3-Bromo-4'-chloro-1,1'-biphenyl Preparation Products And Raw materials |
|