| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 4-Methoxybenzoic acid-[13C6] Basic information |
| Product Name: | 4-Methoxybenzoic acid-[13C6] | | Synonyms: | 4-Methoxybenzoic acid-[13C6];Anisic Acid-[13C6];4-methoxy(1,2,3,4,5,6-13C?)cyclohexa-1,3,5-triene-1-carboxylic acid;4-Methoxybenzoic acid-(phenyl-13C6);Anisic Acid-[13C6] (Standard) | | CAS: | 1173022-97-3 | | MF: | C8H8O3 | | MW: | 158.20132 | | EINECS: | | | Product Categories: | | | Mol File: | 1173022-97-3.mol | ![4-Methoxybenzoic acid-[13C6] Structure](CAS/20180629/GIF/1173022-97-3.gif) |
| | 4-Methoxybenzoic acid-[13C6] Chemical Properties |
| Melting point | 182-185°C | | form | solid | | InChI | 1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/i2+1,3+1,4+1,5+1,6+1,7+1 | | InChIKey | ZEYHEAKUIGZSGI-WBJZHHNVSA-N | | SMILES | CO[13c]1[13cH][13cH][13c]([13cH][13cH]1)C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Methoxybenzoic acid-[13C6] Usage And Synthesis |
| Uses | p-Anisic acid-13C6 is the 13C-labeled p-Anisic acid. p-Anisic acid (4-Methoxybenzoic acid) is one of the isomers of anisic acid, with anti-bacterial and antiseptic properties[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110
[2] DeWeerd K, et al. Metabolism of the 18O-methoxy substituent of 3-methoxybenzoic acid and other unlabeled methoxybenzoic acids by anaerobic bacteria. Appl Environ Microbiol. 1988 May;54(5):1237-42. DOI:10.1128/aem.54.5.1237-1242.1988 |
| | 4-Methoxybenzoic acid-[13C6] Preparation Products And Raw materials |
|