| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | cis-Urocanic Acid-[13C3] Basic information |
| Product Name: | cis-Urocanic Acid-[13C3] | | Synonyms: | CIS-UROCANIC ACID (1,2,3-13C3, 99%);cis-Urocanic acid-1,2,3-13C?;13C3]-cis-Urocanic Acid;cis-Urocanic acid-1,2,3-13C3;Urocanic Acid-13C3 (Standard) | | CAS: | 1173097-34-1 | | MF: | C6H6N2O2 | | MW: | 141.1 | | EINECS: | | | Product Categories: | | | Mol File: | 1173097-34-1.mol | ![cis-Urocanic Acid-[13C3] Structure](CAS/20180629/GIF/1173097-34-1.gif) |
| | cis-Urocanic Acid-[13C3] Chemical Properties |
| Melting point | 226-228 °C | | density | 1.430±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | solid | | InChI | 1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1-/i1+1,2+1,6+1 | | InChIKey | LOIYMIARKYCTBW-BOHCNZJRSA-N | | SMILES | O[13C](=O)\[13CH]=[13CH]/c1c[nH]cn1 | | CAS Number Unlabeled | 7699-35-6 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | cis-Urocanic Acid-[13C3] Usage And Synthesis |
| Uses | Urocanic acid-13C3 is the 13C labeled Urocanic acid[1]. Urocanic acid, produced in the upper layers of mammalian skin, is a major absorber of ultraviolet radiation (UVR)[2]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110
[2] Gibbs NK, et al. Recent advances in urocanic acid photochemistry, photobiology and photoimmunology. Photochem Photobiol Sci. 2008 Jun;7(6):655-67. DOI:10.1039/b717398a |
| | cis-Urocanic Acid-[13C3] Preparation Products And Raw materials |
|