- 2-Fluoro-4-bromonitrobenzene
-
- $5.00 / 1KG
-
2025-09-25
- CAS:321-23-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Fluoro-4-bromonitrobenzene Basic information |
| | 2-Fluoro-4-bromonitrobenzene Chemical Properties |
| Melting point | 83-86 | | Boiling point | 263.2±20.0 °C(Predicted) | | density | 1.375 | | Fp | 86℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | color | Pale yellow to orange | | InChI | InChI=1S/C6H3BrFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H | | InChIKey | VQCWSOYHHXXWSP-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1F | | CAS DataBase Reference | 321-23-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-22 | | Safety Statements | 26-36/37/39-27 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluoro-4-bromonitrobenzene Usage And Synthesis |
| Chemical Properties | White to orange to brown solid | | Uses | Building block for fused aromatic and heteroaromatic compounds |
| | 2-Fluoro-4-bromonitrobenzene Preparation Products And Raw materials |
|