| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Aceroside VIII Basic information |
| Product Name: | Aceroside VIII | | Synonyms: | Aceroside VIII;β-D-Glucopyranoside, (1R)-5-(4-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)ethyl]pentyl 6-O-D-apio-β-D-furanosyl-;Aceroside VIII >=95% (LC/MS-ELSD) | | CAS: | 104109-46-8 | | MF: | C30H42O12 | | MW: | 594.65 | | EINECS: | | | Product Categories: | | | Mol File: | 104109-46-8.mol |  |
| | Aceroside VIII Chemical Properties |
| Boiling point | 880.775±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.445±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | solid | | pka | 10.088±0.15(predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | JLMGCBFIPZDHLZ-GYOMMSMMSA-N | | SMILES | OC[C@]1(O)[C@@H](O)[C@@H](OC1)OC[C@H]([C@@H](O)[C@H](O)[C@H]2O)O[C@H]2O[C@H](CCCCC3=CC=C(O)C=C3)CCC4=CC=C(O)C=C4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Aceroside VIII Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Biological Activity | Aceroside VIII acts as a specific histone deacetylase 6 (HDAC6) inhibitor. It has an ability to synergistically enhance anticancer activity of other HDAC inhibitors in colon cancer cells. |
| | Aceroside VIII Preparation Products And Raw materials |
|