| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Icariside F2
CAS:115009-57-9
Purity:98.0% Package:5mg Remarks:BBP05053
|
|
| | Icariside F2 Basic information |
| Product Name: | Icariside F2 | | Synonyms: | Icariside F2;β-D-Glucopyranoside, phenylmethyl 6-O-D-apio-β-D-furanosyl-;Icariside F2 >=90% (LC/MS-ELSD);Icariside F-2,Icariside F2 | | CAS: | 115009-57-9 | | MF: | C18H26O10 | | MW: | 402.39 | | EINECS: | | | Product Categories: | | | Mol File: | 115009-57-9.mol |  |
| | Icariside F2 Chemical Properties |
| storage temp. | -20°C | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C18H26O10/c19-8-18(24)9-27-17(15(18)23)26-7-11-12(20)13(21)14(22)16(28-11)25-6-10-4-2-1-3-5-10/h1-5,11-17,19-24H,6-9H2/t11-,12-,13+,14-,15+,16-,17-,18-/m1/s1 | | InChIKey | NJMQSVWMCODQIP-FQXXIRCGSA-N | | SMILES | OC[C@@]1(O)CO[C@@H](OC[C@H]2O[C@@H](OCc3ccccc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Icariside F2 Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: Icariside F2 is a glycoside. | | Biological Activity | Icariside F2 is a potent NF-κB inhibitor with IC50 value of 16.25 μM. It is an aromatic glycoside isolated from the leaves of E. ulmoides Oliver. It has anti-inflammatory properties. | | in vitro | At a concentration of 10 μM, Icariside F2 shows little or no cytotoxic activity by the MTT assay. | | target | | NF-κB < span> 16.25 μM (IC 50 ) | |
| | Icariside F2 Preparation Products And Raw materials |
|