| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Metalaxyl-(phenyl-13C6) Basic information |
| | Metalaxyl-(phenyl-13C6) Chemical Properties |
| Melting point | 69-73°C | | density | 1.118±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 100℃ | | storage temp. | -20°C | | form | powder | | InChI | 1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/i6+1,7+1,8+1,10+1,11+1,14+1 | | InChIKey | ZQEIXNIJLIKNTD-HEYPXIGASA-N | | SMILES | COCC(=O)N(C(C)C(=O)OC)[13c]1[13c](C)[13cH][13cH][13cH][13c]1C |
| Hazard Codes | Xn | | Risk Statements | 22-43-52/53 | | Safety Statements | 13-24-37-46-61 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Skin Sens. 1 |
| | Metalaxyl-(phenyl-13C6) Usage And Synthesis |
| Uses | Labelled Metalaxyl (M258740). Agricultural fungicide. Phenylamide fungicide or use in food crops, shrubs and turf. |
| | Metalaxyl-(phenyl-13C6) Preparation Products And Raw materials |
|