| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | non-C2-symmetric bis(oxazoline) ligand Basic information |
| Product Name: | non-C2-symmetric bis(oxazoline) ligand | | Synonyms: | 2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-N-{2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]phenyl}benzenamine;non-C2-symmetric bis(oxazoline) ligand;2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-N-{2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]phenyl}benzenamine 95%;Benzenamine, 2-[(4S)-4,5-dihydro-4-(1-methylethyl)-2-oxazolyl]-N-[2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]phenyl]-;2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-N-{2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]phenyl}benzenamine | | CAS: | 485394-25-0 | | MF: | C25H31N3O2 | | MW: | 405.53 | | EINECS: | | | Product Categories: | | | Mol File: | 485394-25-0.mol |  |
| | non-C2-symmetric bis(oxazoline) ligand Chemical Properties |
| Melting point | 92-96°C | | Boiling point | 530.9±35.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | pka | 4.20±0.70(Predicted) | | InChI | 1S/C25H31N3O2/c1-16(2)21-14-29-23(27-21)17-10-6-8-12-19(17)26-20-13-9-7-11-18(20)24-28-22(15-30-24)25(3,4)5/h6-13,16,21-22,26H,14-15H2,1-5H3/t21-,22-/m1/s1 | | InChIKey | FIJNPJIMVUCDHH-FGZHOGPDSA-N | | SMILES | CC(C)[C@H]1COC(=N1)c2ccccc2Nc3ccccc3C4=N[C@H](CO4)C(C)(C)C |
| RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | non-C2-symmetric bis(oxazoline) ligand Usage And Synthesis |
| Uses | Ligand for Chromium-Catalyzed Homoallenylation of Aldehydes. | | reaction suitability | reagent type: ligand |
| | non-C2-symmetric bis(oxazoline) ligand Preparation Products And Raw materials |
|