| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:N-Methyl bis[(trifluoromethyl)sulfonyl]imide CAS:537031-78-0 Purity:>=90.0% (GC) Package:1G Remarks:742821-1G
|
| Company Name: |
Shanghai EFE Biological Technology Co., Ltd.
|
| Tel: |
021-65675885 18964387627 |
| Email: |
info@efebio.com |
| Products Intro: |
Product Name:N-Methyl bis[(trifluoromethyl)sulfonyl]imide CAS:537031-78-0 Purity:90% Package:2.5g;5g;25g
|
| Company Name: |
Shanghai Jinghui Industrial Co., Ltd.
|
| Tel: |
021-60125035;021-6125035 18019281355 |
| Email: |
vlchemjh@126.com |
| Products Intro: |
Product Name:N-Methyl-bis(trifluoromethanesulfonimide) CAS:537031-78-0 Purity:90% Package:1kg;25kg
|
|
| | N-Methyl-bis(trifluoromethanesulfonimide) Basic information |
| Product Name: | N-Methyl-bis(trifluoromethanesulfonimide) | | Synonyms: | N,N-Bis(trifluoromethylsulfonyl)methylamine;N-Methyl bis[(trifluoromethyl)sulfonyl]imide;N-Methyl-bis(trifluoromethanesulfonimide);N-Methyl bis[(trifluoromethyl)sulfonyl]imide >=90.0% (GC);1,1,1-Trifluoro-N-methyl-N-[(trifluoromethyl)sulfonyl]methanesulfonamide;Methanesulfonamide, 1,1,1-trifluoro-N-methyl-N-[(trifluoromethyl)sulfonyl]-;N-Methyl bis[(trifluoromethyl)sulfonyl]imide | | CAS: | 537031-78-0 | | MF: | C3H3F6NO4S2 | | MW: | 295.18 | | EINECS: | | | Product Categories: | | | Mol File: | 537031-78-0.mol |  |
| | N-Methyl-bis(trifluoromethanesulfonimide) Chemical Properties |
| refractive index | n20/D1.365-1.367 | | storage temp. | 2-8°C | | form | liquid | | BRN | 4495318 | | InChI | 1S/C3H3F6NO4S2/c1-10(15(11,12)2(4,5)6)16(13,14)3(7,8)9/h1H3 | | InChIKey | LMLOOYLJVCUWCD-UHFFFAOYSA-N | | SMILES | CN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Methyl-bis(trifluoromethanesulfonimide) Usage And Synthesis |
| | N-Methyl-bis(trifluoromethanesulfonimide) Preparation Products And Raw materials |
|