| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:(2R,2'R)-2,2'-Bipyrrolidine
CAS:137037-20-8
Purity:95%/98% Package:1G;5G;100G;1KG Remarks:202209
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:(2R，2'R)-2，2'-Bipyrrolidine
CAS:137037-20-8
Purity:98% Package:250mg；1g
|
|
| | (R,R)-2,2′-Bipyrrolidinyl Basic information |
| Product Name: | (R,R)-2,2′-Bipyrrolidinyl | | Synonyms: | (2R,2'R)-2,2'-Bipyrrolidine >=99.0% (GC);(R,R)-2,2′-BIPYRROLIDINE;(R,R)-2,2′-Bipyrrolidinyl;2,2'-Bipyrrolidine, (2R,2'R)-;(2R,2'R)-2,2'-Bipyrrolidine;(2R,2′R)-2,2′-Bipyrrolidine;(2R,2R)-2,2-bispyrrolidine | | CAS: | 137037-20-8 | | MF: | C8H16N2 | | MW: | 140.23 | | EINECS: | | | Product Categories: | | | Mol File: | 137037-20-8.mol |  |
| | (R,R)-2,2′-Bipyrrolidinyl Chemical Properties |
| Melting point | 212-216 °C(Solv: water (7732-18-5)) | | Boiling point | 150 °C(Press: 15 Torr) | | alpha | -14.91 (c 1.03, methanol) | | density | 0.979±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.72±0.10(Predicted) | | form | liquid | | color | colorless | | Sensitive | air sensitive | | BRN | 5376257 | | InChIKey | NQHVTVSAFRAXPA-HTQZYQBOSA-N | | SMILES | N1[C@H](CCC1)[C@@H]2NCCC2 |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259PSN1 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1B |
| | (R,R)-2,2′-Bipyrrolidinyl Usage And Synthesis |
| reaction suitability | reagent type: ligand |
| | (R,R)-2,2′-Bipyrrolidinyl Preparation Products And Raw materials |
|