| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine Basic information |
| Product Name: | 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine | | Synonyms: | 5′-Chloro-2′,3′-isopropylidene adenosine;5′-Chloro-5′-deoxy-2′,3′-O-(1-methylethylidene)adenosine;5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine;Adenosine, 5'-chloro-5'-deoxy-2',3'-O-(1-methylethylidene)- (9CI);5'-Chloro-2',3'-isopropylidene adenosine 97%;Adenosine,5′-chloro-5′-deoxy-2′,3′-O-(1-methylethylidene)-;9-((3aR,4R,6S,6aS)-6-(Chloromethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-9H-purin-6-amine | | CAS: | 24514-56-5 | | MF: | C13H16ClN5O3 | | MW: | 325.75 | | EINECS: | | | Product Categories: | | | Mol File: | 24514-56-5.mol |  |
| | 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine Chemical Properties |
| Melting point | 180-182°C | | storage temp. | 2-8°C | | solubility | Dichloromethane, Methanol | | form | Solid | | color | Off White | | InChI | 1S/C13H16ClN5O3/c1-13(2)21-8-6(3-14)20-12(9(8)22-13)19-5-18-7-10(15)16-4-17-11(7)19/h4-6,8-9,12H,3H2,1-2H3,(H2,15,16,17)/t6-,8-,9-,12-/m1/s1 | | InChIKey | RWTKKXHFQYWSKL-WOUKDFQISA-N | | SMILES | CC1(C)O[C@@H]2[C@@H](CCl)O[C@H]([C@@H]2O1)n3cnc4c(N)ncnc34 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine Usage And Synthesis |
| Uses | 5''-Chloro-5''-deoxy-2'',3''-O-isopropylideneadenosine is an intermediate in the synthesis of S-(5''-Adenosyl)-L-homocysteine which is a novel biomarker for predicting susceptibility of a subject to a mental or neurodegenerative disorder. | | Uses | Versatile nucleoside intermediate. |
| | 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine Preparation Products And Raw materials |
|