| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-(?)-2-AMino-4-Methyl-1,1-diphenyl-1-pentanol CAS:78603-97-1 Purity:98% Package:1G
|
|
| | (S)-(-)-2-AMINO-4-METHYL-1,1-DIPHENYL-1-PENTANOL Basic information |
| | (S)-(-)-2-AMINO-4-METHYL-1,1-DIPHENYL-1-PENTANOL Chemical Properties |
| Melting point | 132-136 °C (lit.) | | Boiling point | 436.6±40.0 °C(Predicted) | | density | 1.059±0.06 g/cm3(Predicted) | | Fp | 48 °C | | pka | 11.41±0.42(Predicted) | | Optical Rotation | [α]20/D 99°, c = 1 in chloroform | | InChI | 1S/C18H23NO/c1-14(2)13-17(19)18(20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17,20H,13,19H2,1-2H3/t17-/m0/s1 | | InChIKey | XECSMDWXBMBRDE-KRWDZBQOSA-N | | SMILES | CC(C)C[C@H](N)C(O)(c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | HS Code | 2922190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(-)-2-AMINO-4-METHYL-1,1-DIPHENYL-1-PENTANOL Usage And Synthesis |
| | (S)-(-)-2-AMINO-4-METHYL-1,1-DIPHENYL-1-PENTANOL Preparation Products And Raw materials |
|