|
| N-NONADECANOPHENONE Basic information |
Product Name: | N-NONADECANOPHENONE | Synonyms: | Nonadecanophenone;Octadecyl Phenyl Ketone;N-nonadecanphenone;PHENYL N-OCTADECYL KETONE;N-OCTADECYL PHENYL KETONE;N-NONADECANOPHENONE;Nonadecanophenone>1-Nonadecanone, 1-phenyl- | CAS: | 103044-68-4 | MF: | C25H42O | MW: | 358.6 | EINECS: | | Product Categories: | | Mol File: | 103044-68-4.mol |  |
| N-NONADECANOPHENONE Chemical Properties |
Melting point | 65 °C | Boiling point | 458.7±14.0 °C(Predicted) | density | 0.892±0.06 g/cm3(Predicted) | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C25H42O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-25(26)24-21-18-17-19-22-24/h17-19,21-22H,2-16,20,23H2,1H3 | InChIKey | WTWRNRBSHQDWMY-UHFFFAOYSA-N | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCCCCCCCCCCC | CAS DataBase Reference | 103044-68-4 |
| N-NONADECANOPHENONE Usage And Synthesis |
| N-NONADECANOPHENONE Preparation Products And Raw materials |
|