| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Potassium 5-hydroxypentanoyltrifluoroborate Basic information |
| | Potassium 5-hydroxypentanoyltrifluoroborate Chemical Properties |
| Melting point | 123.6°C | | form | powder | | InChI | 1S/C5H9BF3O2.K/c7-6(8,9)5(11)3-1-2-4-10;/h10H,1-4H2;/q-1;+1 | | InChIKey | OLLDPQQFLCSTQN-UHFFFAOYSA-N | | SMILES | [K+].OCCCCC(=O)[B-](F)(F)F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Potassium 5-hydroxypentanoyltrifluoroborate Usage And Synthesis |
| Uses | Potassium Acyltrifluroborates (KATs) are bench, air and moisture stable reagents for rapid, chemoselective amide bond formations with hydroxylamines. These amide bond forming reactions proceed under aqueous conditions, without the need for coupling reagents or protecting groups. This product was introduced in collaboration with the Bode Research Group. | | General Description | Potassium 5-hydroxypentanoyltrifluoroborate belongs to the class of compounds known as potassium acyltrifluroborates (KATs). It acts as an acyl donor during the amidation of O-benzoyl hydroxylamine to form the corresponding amide product. |
| | Potassium 5-hydroxypentanoyltrifluoroborate Preparation Products And Raw materials |
|