| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped Basic information |
| | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped Chemical Properties |
| Melting point | 88-95 °C | | density | 1.169 g/mL at 25 °C | | refractive index | n20/D 1.573 | | Fp | 113 °C | | form | liquid | | InChIKey | KHORFZBBHPTCQP-UHFFFAOYSA-N | | SMILES | C(C1C=CC(O)=CC=1)(C1C=CC(O)=CC=1)(C)C.C(C1C=CC(OCC2OC2)=CC=1)(C1C=CC(OCC2OC2)=CC=1)(C)C | | EPA Substance Registry System | Bisphenol A diglycidyl ether bisphenol A polymer (25036-25-3) |
| Hazard Codes | Xi | | Risk Statements | 43-36/37/38 | | Safety Statements | 36/37-36-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Sens. 1 |
| | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped Usage And Synthesis |
| Description | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped is a thermoplastic polymer that can be used for automotive parts, coatings, and other industrial applications. Poly(BPA-co-EPI) has been shown to have excellent resistance to thermal degradation, good mechanical properties at high temperatures, and good radiation resistance. The polymer is resistant to ethylene and styrene monomer evaporation during processing. Generally, the material can be used as a substitute for polyethylene terephthalate (PET), polyvinyl chloride (PVC), or acrylonitrile butadiene styrene (ABS). | | Toxics Screening Level | The ITSL for diglycidyl ether of bisphenol a has been changed from 0.04 μg/m3 to 0.1 μg/m3
based on annual averaging time. |
| | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped Preparation Products And Raw materials |
|