| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 3-Indazolinone
-
- $8.80
-
2019-07-11
- CAS:7364-25-2
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | 3-Indazolinone Basic information |
| | 3-Indazolinone Chemical Properties |
| Melting point | 250-252 °C (lit.) | | Boiling point | 247.23°C (rough estimate) | | density | 1.2296 (rough estimate) | | refractive index | 1.5880 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 11.94±0.20(Predicted) | | color | White to Light yellow to Light orange | | λmax | 306nm(MeOH)(lit.) | | BRN | 3733 | | InChI | InChI=1S/C7H6N2O/c10-7-5-3-1-2-4-6(5)8-9-7/h1-4H,(H2,8,9,10) | | InChIKey | SWEICGMKXPNXNU-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(=O)N1 | | CAS DataBase Reference | 7364-25-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3H-indazol-3-one, 1,2-dihydro-(7364-25-2) | | EPA Substance Registry System | 3H-Indazol-3-one, 1,2-dihydro- (7364-25-2) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 3-Indazolinone Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 3-Indazolinone is used as catalytic agent, petrochemical additive. |
| | 3-Indazolinone Preparation Products And Raw materials |
|