|
|
| | EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE Basic information |
| Product Name: | EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE | | Synonyms: | EXO-7-OXABICYCLO[2.2.1]HEPTENE-2,3-DICARBOXYLIC ANHYDRIDE;EXO-7-OXABICYCLO[2.2.1]HEPT-5-ENE-2,3-DICARBOXYLIC ANHYDRIDE;EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE;3a-alpha,4-beta,7-beta,7a-alpha-tetrahydro-4,7-epoxyisobenzofuran-1,3-dione;4,7-epoxyisobenzofuran-1,3-dione,3a,4,7,7a-tetrahydro-,(3a-alpha,4-beta,7-bet;7a-alpha)-;EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE 98+%;EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE 97% | | CAS: | 6118-51-0 | | MF: | C8H6O4 | | MW: | 166.13 | | EINECS: | 629-406-1 | | Product Categories: | Epoxide Monomers;Monomers;Polymer Science;Norbornene Derivatives;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 6118-51-0.mol |  |
| | EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE Chemical Properties |
| Melting point | 118 °C (dec.)(lit.) | | Boiling point | 372.0±42.0 °C(Predicted) | | density | 1.540±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Hydrolyzes in water. | | Sensitive | Moisture Sensitive | | BRN | 10355 | | InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ | | InChIKey | QQYNRBAAQFZCLF-FBXFSONDSA-N | | SMILES | O=C1OC(=O)[C@H]2C3OC(C=C3)[C@@H]12 | | CAS DataBase Reference | 6118-51-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | KC9650000 | | F | 10-21 | | TSCA | Yes | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | white crystalline powder or chunks | | Uses | Intermediate in a useful synthesis of 4,4-dialkyl-2-butenolides, based on reaction with two moles of Grignard reagent, followed by cycloreversion (elimination of furan) to release the double bond. | | References | [1] Tetrahedron Letters, 2008, vol. 49, # 39, p. 5680 - 5682 [2] Bioorganic Chemistry, 2003, vol. 31, # 1, p. 68 - 79 [3] Medicinal Chemistry Research, 2017, vol. 26, # 4, p. 779 - 786 [4] Green Chemistry, 2013, vol. 15, # 5, p. 1318 - 1325 [5] Medicinal Chemistry, 2014, vol. 10, # 4, p. 376 - 381 |
| | EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE Preparation Products And Raw materials |
|