|
|
| | 1,3-DICHLOROTETRAMETHYLDISILOXANE Basic information |
| Product Name: | 1,3-DICHLOROTETRAMETHYLDISILOXANE | | Synonyms: | 1,3-DICHLOROTETRAMETHYLDISILOXANE 96%;bis(chlorodimethylsilyl)ether;Disiloxane, 1,3-dichloro-1,1,3,3-tetramethyl-;disiloxane,1,3-dichloro-1,1,3,3-tetramethyl-;Sym-dichlorotetramethyldisiloxane;1,1,3,3-Tetramethyl-1,3-dichlorodisiloxane;1,3-Dichloro-1,1,3,3-tetramethylpropanedisiloxane;Oxybis(chlorodimethylsilane) | | CAS: | 2401-73-2 | | MF: | C4H12Cl2OSi2 | | MW: | 203.21 | | EINECS: | 219-278-1 | | Product Categories: | Monochlorosilanes;Protection & Derivatization Reagents (for Synthesis);Si (Classes of Silicon Compounds);Si-Cl Compounds;Siloxanes;Si-O Compounds;Synthetic Organic Chemistry;Protecting and Derivatizing Reagents;Protection and Derivatization;Silicon-Based | | Mol File: | 2401-73-2.mol |  |
| | 1,3-DICHLOROTETRAMETHYLDISILOXANE Chemical Properties |
| Melting point | -37 °C | | Boiling point | 138 °C (lit.) | | density | 1.039 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.407(lit.) | | Fp | 15 °C | | storage temp. | Flammables area | | form | liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.038 | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 1741218 | | InChI | 1S/C4H12Cl2OSi2/c1-8(2,5)7-9(3,4)6/h1-4H3 | | InChIKey | DMEXFOUCEOWRGD-UHFFFAOYSA-N | | SMILES | C[Si](C)(Cl)O[Si](C)(C)Cl | | CAS DataBase Reference | 2401-73-2(CAS DataBase Reference) | | EPA Substance Registry System | Disiloxane, 1,3-dichloro-1,1,3,3-tetramethyl- (2401-73-2) |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 16-26-27-36/37/39-45 | | RIDADR | UN 2985 3/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2
Skin Corr. 1B |
| | 1,3-DICHLOROTETRAMETHYLDISILOXANE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,3-Dichlorotetramethyldisiloxane is used to produce 1,1,3,3-tetramethyl-disiloxane-1,3-diol. It is also used as Chemical Additives. Pharmaceutical intermediates. | | Synthesis | General procedure: The chlorination reaction needs to be carried out in THF to ensure that all Si-H bonds are chlorinated, using TCCA as the chlorinating agent (molar ratio 1:1, TCCA:siloxane). This was done as follows: 1,1,3,3-tetramethyldisiloxane and THF (ratio 20 ml THF/g siloxane) were added to the reaction flask and the mixture was cooled to -20 °C. TCCA was added in batches with vigorous stirring, and after the addition of TCCA, stirring was continued for 15 min, after which the cooling bath was removed and the reaction mixture was allowed to warm slowly to room temperature. It should be noted that the chain length of the siloxane, the type of substituent and the position of the Si-H bond may affect the method of isolation and characterization of the subsequent products. Upon completion of the reaction, THF and unreacted TCCA should be removed immediately to avoid denaturation of the products during storage. | | References | [1] Journal of Organometallic Chemistry, 2007, vol. 692, # 10, p. 1892 - 1897
[2] Journal of Organometallic Chemistry, 2018, vol. 875, p. 1 - 4
[3] Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1970, p. 1641 - 1642 |
| | 1,3-DICHLOROTETRAMETHYLDISILOXANE Preparation Products And Raw materials |
|