|
|
| | (2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane Basic information |
| Product Name: | (2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane | | Synonyms: | tert-Butyl [(S)-1-[(S)-Oxiran-2-yl]-2-phenylethyl]carbamate
(2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane;(2R,3S)-1,2-Epoxy-3-(Boc-aMino)-4-phenylbutane, 95+%;(2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane 99%;(2S,3S)-3-Boc-amino-1,2-epoxy-4-phenylbutane, >=99%;3S-(T-BOC)AMINO-1,2-(S)-EPOXY-4-PHENYLBUTANE;[(1S)-1-((2S)-Oxiranyl)-2-phenylethyl]carbaMic Acid tert-Butyl;TERT-BUTYL [S-(R,R)]-(-)-(1-OXIRANYL-2-PHENYLETHYL)CARBAMATE;T-BUTYL [S-(R*,R*)]-(-)-(1-OXIRANYL-2-PHENYLETHYL)CARBAMATE | | CAS: | 98737-29-2 | | MF: | C15H21NO3 | | MW: | 263.33 | | EINECS: | 425-420-5 | | Product Categories: | API intermediates;Aromatics Compounds;Aromatics;Chiral Reagents;Heterocycles;chiral | | Mol File: | 98737-29-2.mol |  |
| | (2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane Chemical Properties |
| Melting point | 125-127 °C(lit.) | | alpha | -7°(23℃, c=0.6, CH3OH) | | Boiling point | 398.8±25.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | soluble in Chloroform, Dichloromethane, Ethyl Acetate, Methanol | | pka | 12.19±0.46(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]23/D 7°, c = 0.6 in methanol | | Water Solubility | Insoluble in water. Soluble in Chloroform, Dichloromethane and Ethyl Acetate. | | InChI | InChI=1S/C15H21NO3/c1-15(2,3)19-14(17)16-12(13-10-18-13)9-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,16,17)/t12-,13+/m0/s1 | | InChIKey | NVPOUMXZERMIJK-QWHCGFSZSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]([C@H]1CO1)CC1=CC=CC=C1 | | CAS DataBase Reference | 98737-29-2(CAS DataBase Reference) |
| Hazard Codes | F,Xi,N | | Risk Statements | 10-36/37/38-50/53 | | Safety Statements | 7/9-16-26-36/37/39-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | (2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Atazanavir intermediate. Enantiomer S | | Uses | It function as a building block employed in the synthesis of HIV-1 protease inhibitors and is also employed in synthesizing (hydroxyethyl)urea peptidomimetrics and arylsulfonamides possessing anti-HIV activity. It is a Enantiomer S. Atazanavir intermediate. |
| | (2S,3S)-1,2-Epoxy-3-(Boc-amino)-4-phenylbutane Preparation Products And Raw materials |
|