DBCO-PEG4-SE manufacturers
- DBCO-PEG4-NHS
-
-
2026-07-24
- CAS:1427004-19-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- DBCO-PEG4-NHS ester
-
-
2025-06-07
- CAS:1427004-19-0
- Min. Order: 50mg
- Purity: >99.00%
- Supply Ability: 250
|
| | DBCO-PEG4-SE Basic information |
| Product Name: | DBCO-PEG4-SE | | Synonyms: | DBCO-PEG4-SE;DBCO-PEG4-succinimidyl ester;DBCO-CONH-PEG4-NHS ester;2,5-Dioxo-1-pyrrolidinyl 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-17,20-dioxo-4,7,10,13-tetraoxa-16-azaeicosanoate;4,7,10,13-Tetraoxa-16-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-17,20-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester;DBCO-PEG4-SPA;inhibit,Inhibitor,DBCO PEG4 NHS ester,DBCOPEG4NHS ester,DBCO-PEG-4-NHS ester,PROTAC Linkers;DBCO-PEG4-NHS easer | | CAS: | 1427004-19-0 | | MF: | C34H39N3O10 | | MW: | 649.69 | | EINECS: | | | Product Categories: | peg;ADC-Linkers | | Mol File: | 1427004-19-0.mol |  |
| | DBCO-PEG4-SE Chemical Properties |
| density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | pka | 15.14±0.46(Predicted) | | form | gel or oil | | color | Colourless to yellow | | InChIKey | RRCXYKNJTKJNTD-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCNC(=O)CCC(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)=O |
| WGK Germany | 3 | | HS Code | 2942000090 |
| | DBCO-PEG4-SE Usage And Synthesis |
| Description | DBCO-PEG4-NHS Ester is a click chemistry PEG reagent containing NHS ester that is able to react specifically and efficiently with primary amines (e.g. the side chain of lysine residues or aminosilane-coated surfaces) at neutral or slightly basic condition to form a covalent bond. The hydrophilic PEG spacer arm improves water solubility and provides a long and flexible connection that minimizes steric hindrance involved with ligation. DBCO is commonly used for copper-free Click Chemistry reactions. | | Uses | Succinimidyl ester (NHS, amine reactive) functionalized cyclooctyne derivative for incorporation of the cyclooctyne moiety into amine containing compounds or biomolecules. Cyclooctynes are useful in strain-promoted copper-free click chemistry cycloaddition reactions. This dibenzocyclooctyne will react with azide functionalized compounds or biomolecules without the need for a Cu(I) catalyst to result in a stable triazole linkage.
Applications Include:
- Protein-peptide conjugates
- Antibody-enzyme or antibody-drug conjugates
- Protein or peptide-oligonucleotide conjugates
- Surface modification
| | reaction suitability | reaction type: click chemistry
reagent type: linker | | IC 50 | PEGs |
| | DBCO-PEG4-SE Preparation Products And Raw materials |
|