- Gatifloxacin Macrolide
-
- $0.00 / 1Kg/Bag
-
2026-05-12
- CAS:112811-71-9
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 500kgs
|
| | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid ethyl ester Basic information |
| | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid ethyl ester Chemical Properties |
| Melting point | 179-181°C | | Boiling point | 459.7±45.0 °C(Predicted) | | density | 1.414±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -2.98±0.40(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C16H15F2NO4/c1-3-23-16(21)10-7-19(8-4-5-8)13-9(14(10)20)6-11(17)12(18)15(13)22-2/h6-8H,3-5H2,1-2H3 | | InChIKey | XPAOPAPDCRLMTR-UHFFFAOYSA-N | | SMILES | N1(C2CC2)C2=C(C=C(F)C(F)=C2OC)C(=O)C(C(OCC)=O)=C1 | | CAS DataBase Reference | 112811-71-9(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2933.49.7000 | | Storage Class | 11 - Combustible Solids |
| | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid ethyl ester Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Gatifloxacin intermediate. |
| | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid ethyl ester Preparation Products And Raw materials |
|