4-O-Feruloylquinic acid manufacturers
|
| | 4-O-Feruloylquinic acid Basic information |
| Product Name: | 4-O-Feruloylquinic acid | | Synonyms: | 4-O-Feruloylquinic acid;(1alpha,3R,4alpha,5R)-1,3,5-Trihydroxy-4-[[3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]cyclohexanecarboxylic acid;4-Feruloylquinic acid;4-O-feruloyl-D-quinic acid;4-Feruoylquinic acid;Cyclohexanecarboxylic acid, 1,3,5-trihydroxy-4-[[3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1α,3R,4α,5R)-;4-O-Feruloylquinic Acid
DISCONTINUED. Please see F308985.;4-Feruloylquinic acid,inhibit,4 O Feruloylquinic acid,Inhibitor,4OFeruloylquinic acid | | CAS: | 2613-86-7 | | MF: | C17H20O9 | | MW: | 368.34 | | EINECS: | | | Product Categories: | | | Mol File: | 2613-86-7.mol |  |
| | 4-O-Feruloylquinic acid Chemical Properties |
| Melting point | 195-196 °C(Solv: water (7732-18-5)) | | Boiling point | 656.1±55.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 4.07±0.50(Predicted) | | color | White to off-white | | Major Application | food and beverages
pharmaceutical | | InChI | InChI=1/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/t11-,12-,15-,17+/s3 | | InChIKey | VTMFDSJJVNQXLT-YYJRJVKZNA-N | | SMILES | O([C@@H]1[C@@H](C[C@@](O)(C(=O)O)C[C@H]1O)O)C(=O)C=CC1C=CC(O)=C(OC)C=1 |&1:1,2,4,10,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-O-Feruloylquinic acid Usage And Synthesis |
| Uses | 4-O-Feruloylquinic Acid is a methanolic extract of Murraya Paniculata leaves that exhibits antioxidant and antimicrobial properties against fungi, gram positive and gram negative bacteria. | | Definition | ChEBI: 4-O-feruloylquinic acid is an organic molecular entity. |
| | 4-O-Feruloylquinic acid Preparation Products And Raw materials |
|