Bis(2,4-di-tert-butylphenylphosphate manufacturers
|
| | Bis(2,4-di-tert-butylphenylphosphate Basic information |
| Product Name: | Bis(2,4-di-tert-butylphenylphosphate | | Synonyms: | Bis(2,4-di-tert-butylphenylphosphate;Phenol, 2,4-bis(1,1-dimethylethyl)-, 1,1'-(hydrogen phosphate);2,4-Bis(1,1-dimethylethyl)-,1,1'-(hydrogenphosphate)phenol;Bis(2,4-di-tert-butylphenyl) phosphate;Bis(2,4-di-tert-butylphenyl) hydrogen phosphate - [B72780];2,4-Bis(1,1-dimethylethyl)-,1,1'-(hydrogenphosphate)phenol;bis(2,4-ditert-butylphenyl)phosphoric acidester;2,4-Bis(1,1-dimethylethyl)phenol phosphate | | CAS: | 69284-93-1 | | MF: | C28H43O4P | | MW: | 474.62 | | EINECS: | | | Product Categories: | | | Mol File: | 69284-93-1.mol |  |
| | Bis(2,4-di-tert-butylphenylphosphate Chemical Properties |
| Boiling point | 516.2±60.0 °C(Predicted) | | density | 1.046±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Very Slightly), Methanol (Slightly) | | pka | 1.21±0.50(Predicted) | | form | Solid | | color | White to Off-White | | InChI | 1S/C28H43O4P/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)31-33(29,30)32-24-16-14-20(26(4,5)6)18-22(24)28(10,11)12/h13-18H,1-12H3,(H,29,30) | | InChIKey | GUDSEWUOWPVZPC-UHFFFAOYSA-N | | SMILES | OP(OC1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1)(OC2=CC=C(C(C)(C)C)C=C2C(C)(C)C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Bis(2,4-di-tert-butylphenylphosphate Usage And Synthesis |
| Uses | Bis(2,4-di-tert-butylphenyl) Hydrogen Phosphate can be used to prepare organic phosphate nucleating agent to improve processing performance of resins. |
| | Bis(2,4-di-tert-butylphenylphosphate Preparation Products And Raw materials |
|